| Identification | |
| Name: | Benzene,1-chloro-3-iodo- |
| Synonyms: | 3-Iodochlorobenzene;NSC 32861;m-Chloroiodobenzene;3-Chloroiodobenzene;3-Chlorophenyl iodide;3-Chloro-1-iodobenzene;1-Iodo-3-chlorobenzene; |
| CAS: | 625-99-0 |
| EINECS: | 210-920-6 |
| Molecular Formula: | C6H4ClI |
| Molecular Weight: | 238.45 |
| InChI: | InChI=1/C6H4ClI/c7-5-2-1-3-6(8)4-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 54.5 |
| Density: | 1.926 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.631 |
| Solubility: | Insoluble |
| Appearance: | clear light yellow clear liquid. |
| Specification: |
Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Avoid contact with eyes, skin, and clothing. Avoid ingestion and inhalation.Store in a cool, dry place. Keep container closed when not in use. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
