| Identification | |
| Name: | 9,12-Octadecadienoicacid, (9E,12Z)- |
| Synonyms: | 9,12-Octadecadienoicacid, (Z,E)- (8CI); (9E,12Z)-9,12-Octadecadienoic acid;9-trans,12-cis-Octadecadienoic acid; trans-9-cis-12-Octadecadienoic acid |
| CAS: | 2420-42-0 |
| Molecular Formula: | C18H32 O2 |
| Molecular Weight: | 280.4455 |
| InChI: | InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6+,10-9- |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -8.5 deg C |
| Flash Point: | 273°C |
| Boiling Point: | 360.6°Cat760mmHg |
| Density: | 0.911g/cm3 |
| Refractive index: | 1.478 |
| Solubility: | Freely sol in ether; sol in absolute alcohol; 1 ml dissolves in 10 ml petroleum ether; miscible with dimethylformamide, fat solvents, oils Very soluble in acetone, benzene, ethyl ether, and ethanol. In acetone: 4.10 g/100 g acetone at -50 deg C, 1.20 g/100 g acetone at -60 deg C, 0.35 g/100 g acetone at -70 deg C; in n-heptane: 0.98 g/100 g n-heptane at -50 deg C, 0.20 g/100 g n-heptane at -60 deg C, 0.042 g/100 g n-heptane at -70 deg C. In water, 0.139 mg/L at 25 deg C (est) |
| Flash Point: | 273°C |
| Color: | Colorless oil Colorless to straw-colored liquid |
| Safety Data | |
 |
|
