| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, 2-aminoethyl ester, hydrochloride (1:1) |
| Synonyms: | 2-Propenoicacid, 2-methyl-, 2-aminoethyl ester, hydrochloride (9CI); Methacrylic acid,2-aminoethyl ester, hydrochloride (7CI,8CI); Ethanol, 2-amino-, methacrylate(ester), hydrochloride (8CI); 2-Aminoethyl 2-methylacrylate hydrochloride;2-Aminoethyl methacrylate hydrochloride |
| CAS: | 2420-94-2 |
| EINECS: | 219-343-4 |
| Molecular Formula: | C6H11 N O2 . Cl H |
| Molecular Weight: | 165.62 |
| InChI: | InChI=1/C6H11NO2/c1-5(2)6(8)9-4-3-7/h1,3-4,7H2,2H3/p+1 |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | white to light green to light brown crystalline powder |
| Specification: |
2-Aminoethyl methacrylate hydrochloride (CAS NO.2420-94-2) is also named as 2-Aminoethyl 2-methylprop-2-enoate hydrochloride (1:1) ; 2-Propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride ; 2-Propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride (1:1) . 2-Aminoethyl methacrylate hydrochloride (CAS NO.2420-94-2) is white to almost white crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
