| Identification | |
| Name: | 4-Benzyloxy-3-methoxybenzaldehyde |
| Synonyms: | o-Benzylvanillin; 4-(benzyloxy)-3-methoxy benzaldehyde |
| CAS: | 2426-87-1 |
| EINECS: | 219-379-0 |
| Molecular Formula: | C15H14O3 |
| Molecular Weight: | 242.27 |
| InChI: | InChI=1/C15H14O3/c1-17-15-9-13(10-16)7-8-14(15)18-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 183.1°C |
| Boiling Point: | 213-215°C 3,5mm |
| Density: | 1.154g/cm3 |
| Refractive index: | 1.59 |
| Appearance: | Yellow crystalline powder or crystalline chunks |
| Specification: | YELLOW CRYSTALLINE POWDER OR CRYSTALLINE CHUNKS Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 183.1°C |
| Storage Temperature: | Refrigerator, Under Inert Atmosphere |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
