| Identification |
| Name: | 3-Methoxybenzaldehyde |
| Synonyms: | 3-Methoxy benzaldehyde;3-methoxy-benzaldehyde;3-methoxybenzal;Metamethoxybenzaldehyde;Benzaldehyde, 3-methoxy-;m-Anisaldehyde;4-08-00-00241 (Beilstein Handbook Reference);3-Anisaldehyde;m-Methoxybenzaldehyde; |
| CAS: | 591-31-1 |
| EINECS: | 209-712-8 |
| Molecular Formula: | C8H8O2 |
| Molecular Weight: | 136.15 |
| InChI: | InChI=1/C8H8O2/c1-10-8-4-2-3-7(5-8)6-9/h2-6H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.119 |
| Stability: | Stable under normal temperatures and pressures. Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.55-1.554 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Clear brown liquid. |
| HS Code: | 29124900 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
