| Identification | |
| Name: | Propanoic acid,2-[2-[3-methoxy-1-(methoxymethyl)propylidene]hydrazinylidene]-, ethyl ester |
| Synonyms: | Propanoicacid, 2-[[3-methoxy-1-(methoxymethyl)propylidene]hydrazono]-, ethyl ester(9CI); Pyruvic acid, ethyl ester, 2-azine with 1,4-dimethoxy-2-butanone (8CI);2-Butanone, 1,4-dimethoxy-, 2-azine with ethyl pyruvate (8CI);1,4-Dimethoxy-2-butanone, azine with ethyl pyruvate; NSC 105796 |
| CAS: | 24360-67-6 |
| Molecular Formula: | C11H20 N2 O4 |
| Molecular Weight: | 244.2875 |
| InChI: | InChI=1/C11H20N2O4/c1-5-17-11(14)9(2)12-13-10(8-16-4)6-7-15-3/h5-8H2,1-4H3/b12-9-,13-10- |
| Molecular Structure: | ![(C11H20N2O4) Propanoicacid, 2-[[3-methoxy-1-(methoxymethyl)propylidene]hydrazono]-, ethyl ester(9CI); Pyruvic aci...](https://img1.guidechem.com/chem/e/dict/189/24360-67-6.jpg) |
| Properties | |
| Flash Point: | 119.2°C |
| Boiling Point: | 314.9°Cat760mmHg |
| Density: | 1.05g/cm3 |
| Refractive index: | 1.459 |
| Flash Point: | 119.2°C |
| Safety Data | |
 |
|
