| Identification | |
| Name: | 1-Octen-3-ol, 3-acetate |
| Synonyms: | 1-Octen-3-ol,acetate (6CI,7CI,8CI,9CI); 1-Octen-3-yl acetate; 1-Octene-3-ol acetate;1-Octenyl-3-yl acetate; 1-Pentylallyl acetate; 3-Acetoxy-1-octene;Amylvinylcarbinol acetate |
| CAS: | 2442-10-6 |
| EINECS: | 219-474-7 |
| Molecular Formula: | C10H18 O2 |
| Molecular Weight: | 170.25 |
| InChI: | InChI=1/C10H18O2/c1-4-6-7-8-10(5-2)12-9(3)11/h5,10H,2,4,6-8H2,1,3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 165? |
| Density: | 0.878 |
| Refractive index: | 1.425 |
| Specification: |
The chemical synonyms of 1-Octen-3-yl acetate (2442-10-6) are Oct-1-en-3-yl acetate ; Octenyl acetate ; 1-Octen-3-ol,acetate ; 1-Pentylallylacetate ; Amylvinylcarbinolacetate ; Octen-3-yl acetate ; Amyl vinyl carbinyl acetate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 165? |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
