| Identification | |
| Name: | 1-Octen-3-ol |
| Synonyms: | Oct-1-en-3-ol;Amyl vinyl carbinol;Matsutake alcohol;Vinyl amyl carbinol;3-Hydroxy-1-octene;Mushroom alcohol;1-octene-3-ol; |
| CAS: | 3391-86-4 |
| EINECS: | 222-226-0 |
| Molecular Formula: | C8H16O |
| Molecular Weight: | 128.21 |
| InChI: | InChI=1/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 0.837 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.434-1.442 |
| Solubility: | Insoluble |
| Appearance: | Clear colorless to pale yellow liquid |
| Specification: |
?1-Octen-3-ol (CAS NO.3391-86-4), its Synonyms are 1-Okten-3-ol ; 1-Vinylhexanol ; 3-Hydroxy-1-octene ; 3-Octenol ; Amyl vinyl carbinol ; Amylvinylcarbinol ; Matsuica alcohol ; Matsutake alcohol ; Pentyl vinyl carbinol ; Pentylvinylcarbinol ; Vinyl amyl carbinol . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29052990 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. Store in a cool, dry area away from incompatible substances. |
| Usage: | Pheromone, fragrance, insect repellent, dog and cat repellent. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
