| Identification | |
| Name: | 2H-1-Benzopyran-2-one,7-methyl- |
| Synonyms: | Coumarin,7-methyl- (6CI,7CI,8CI); 7-Methyl-2H-1-benzopyran-2-one;7-Methyl-2H-chromen-2-one; 7-Methylchromen-2-one; 7-Methylcoumarin; NSC 19511 |
| CAS: | 2445-83-2 |
| EINECS: | 219-499-3 |
| Molecular Formula: | C10H8 O2 |
| Molecular Weight: | 160.18 |
| InChI: | InChI=1/C10H8O2/c1-7-2-3-8-4-5-10(11)12-9(8)6-7/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 128-130 °C(lit.) |
| Flash Point: | 125.9°C |
| Boiling Point: | 171-172 °C11 mm Hg(lit.) |
| Density: | 1.2g/cm3 |
| Refractive index: | 1.583 |
| Specification: | Safety Statements:1-13-45 1:Keep locked up 13:Keep away from food, drink and animal feeding stuffs 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 125.9°C |
| Safety Data | |
 |
|
