| Identification | |
| Name: | 6-Aminocoumarin coumarin-3-carboxylic acid salt |
| Synonyms: | 6-Aminocoumarin coumarin-3-carboxylic acid salt;2H-1-Benzopyran-3-carboxylic acid, 2-oxo-, ester with 5-aminocoumarin;AC1L44TA;LS-39226;6-aminochromen-2-one; 2-oxochromene-3-carboxylic acid;2448-39-7 |
| CAS: | 2448-39-7 |
| Molecular Formula: | C19H10NO6 |
| Molecular Weight: | 351.3096 |
| InChI: | InChI=1/C10H6O4.C9H7NO2/c11-9(12)7-5-6-3-1-2-4-8(6)14-10(7)13;10-7-2-3-8-6(5-7)1-4-9(11)12-8/h1-5H,(H,11,12);1-5H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 162.7°C |
| Boiling Point: | 388.6°C at 760 mmHg |
| Specification: |
6-Aminocoumarin coumarin-3-carboxylic acid salt , its cas register number is 2448-39-7. It also can be called 2H-1-Benzopyran-3-carboxylic acid, 2-oxo-, ester with 5-aminocoumarin . When 6-Aminocoumarin coumarin-3-carboxylic acid salt (CAS NO.2448-39-7) is heated to decomposition it emits toxic fumes of NOx. |
| Flash Point: | 162.7°C |
| Safety Data | |
 |
|
