| Identification | |
| Name: | 2,6-Diisopropylaniline |
| Synonyms: | Diisopropylaniline,90% |
| CAS: | 24544-04-5 |
| EINECS: | 246-305-4 |
| Molecular Formula: | C12H19N |
| Molecular Weight: | 177.29 |
| InChI: | InChI=1/C12H19N/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9H,13H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 180kgs |
| Density: | 0.94 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.532-1.534 |
| Water Solubility: | <0.20 g/L |
| Solubility: | <0.20 g/L inwater |
| Appearance: | Clear liquid |
| Specification: |
2,6-Diisopropylaniline , with CAS number of 24544-04-5, can be called 2,6-Bis(1-methylethyl)aniline ; 2,6-Bis(1-methylethyl)benzenamine ; 2,6-Diisopropylphenylamine ; N-(2,6-Diisopropylphenyl)amine . 2,6-Diisopropylaniline (CAS NO.24544-04-5) is stable under normal temperatures and pressures, but incompatible with strong oxidizing agents, acids, acid chlorides, acid anhydrides, chloroformates. The colorless to pale orange liquid slightly soluble in water and the solubility is less than 0.20g/L. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29214980 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | 2,6-Diisopropylaniline is used as intermediate for the manufacture of carbodiimides stabilizers, RIM-PUR, synthetic resins, pesticides, antioxidants, pharmaceuticals and other products. WWW Link |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
