| Identification | |
| Name: | b-D-Glucopyranoside, 4-nitrophenyl |
| Synonyms: | Glucopyranoside,p-nitrophenyl, b-D-(6CI,7CI,8CI);4-Nitrophenyl b-D-glucopyranoside;4-Nitrophenyl b-D-glucoside;p-Nitrophenol b-D-glucoside;p-Nitrophenylglucopyranoside;p-Nitrophenyl b-D-glucopyranoside;p-Nitrophenyl b-D-glucoside;p-Nitrophenyl b-glucoside; |
| CAS: | 2492-87-7 |
| EINECS: | 219-661-3 |
| Molecular Formula: | C12H15NO8 |
| Molecular Weight: | 301.25 |
| InChI: | InChI=1/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.599 g/cm3 |
| Refractive index: | -102.5 ° (C=1, H2O) |
| Appearance: | white to off white to yellow powder |
| Specification: |
b-D-Glucopyranoside, 4-nitrophenyl , with CAS number of 2492-87-7, can be called .beta.-D-glucopyranoside, 4-nitrophenyl ; beta-D-Glucopyranoside, 4-nitrophenyl (9CI) ; beta-D-glucopyranoside, 4-nitrophenyl ; para-Nitrophenyl b-D-glucopyranoside ; Glucopyranoside,p-nitrophenyl, b-D-(6CI,7CI,8CI) ; 4-Nitrophenyl b-D-glucopyranoside . It is a white crystal. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
