| Identification | |
| Name: | b-D-Glucopyranoside, 2-nitrophenyl |
| Synonyms: | Glucopyranoside,o-nitrophenyl, b-D-(7CI,8CI);2-Nitrophenyl b-D-glucopyranoside;2-Nitrophenyl b-D-glucoside;o-Nitrophenyl b-D-glucopyranoside;o-Nitrophenylb-D-glucoside;o-Nitrophenyl b-glucoside; |
| CAS: | 2816-24-2 |
| EINECS: | 220-568-5 |
| Molecular Formula: | C12H15NO8 |
| Molecular Weight: | 301.25 |
| InChI: | InChI=1/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-4-2-1-3-6(7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.599 g/cm3 |
| Refractive index: | 1.648 |
| Appearance: | white to yellow powder |
| Specification: |
b-D-Glucopyranoside, 2-nitrophenyl , with CAS number of 2816-24-2, can be called 2-Nitrophenyl .beta.-D-glucopyranoside ; beta-D-Glucopyranoside, 2-nitrophenyl (9CI) ; o-Nitrophenyl .beta.-D-glucopyranoside ; o-Nitrophenyl beta-D-glucopyranoside . |
| Storage Temperature: | 2-8°C |
| Color: | light yellow |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
