| Identification | |
| Name: | Propanoic acid,2-(2-chlorophenoxy)- |
| CAS: | 25140-86-7 |
| Molecular Formula: | C9H9 Cl O3 |
| Molecular Weight: | 200.62 |
| InChI: | InChI=1/C9H9ClO3/c1-6(9(11)12)13-8-5-3-2-4-7(8)10/h2-6H,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.307 g/cm3 |
| Appearance: | cream to beige crystalline powder |
| Specification: |
2-(2-Chlorophenoxy)propionic acid (CAS NO.25140-86-7) is also called (+/-)-2-(2-chlorophenoxy)propionic acid ; 2-(2-Chlorophenoxy)propanoic acid ; 2-(o-Chlorophenoxy)propionic acid ; AI3-14676 ; Acide (o-chlorophenoxy)-2 propionique ; Acide (o-chlorophenoxy)-2 propionique [French] ; Propanoic acid, 2-(2-chlorophenoxy)- . 2-(2-Chlorophenoxy)propionic acid (CAS NO.25140-86-7) is cream to beige crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
