| Identification | |
| Name: | 5-Chloro-2-nitrobenzoic acid |
| Synonyms: | - |
| CAS: | 2516-95-2 |
| EINECS: | 219-738-1 |
| Molecular Formula: | C7H4ClNO4 |
| Molecular Weight: | 201.57 |
| InChI: | InChI=1/C7H4ClNO4/c8-4-1-2-6(9(12)13)5(3-4)7(10)11/h1-3H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Flash Point: | 362 oC at 760 mmHg |
| Boiling Point: | 362 oC at 760 mmHg |
| Density: | 1.602g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | Slightly Soluble |
| Appearance: | Yellow to greenish crystalline powder |
| Specification: |
?5-Chloro-2-nitrobenzoic acid (CAS NO.2516-95-2), its Synonyms are Benzoic acid, 5-chloro-2-nitro- ; 5-Chloro-2-nitro-benzoicaci ; 2-Nitro-5-chlorobenzoic acid . It is light yellow to yellowish-green crystalline powder. |
| HS Code: | 29163900 |
| Flash Point: | 362 oC at 760 mmHg |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
