| Identification |
| Name: | 2-Chloro-5-nitrobenzoic acid |
| Synonyms: | 5-nitro-2-chlorobenzoic acid |
| CAS: | 2516-96-3 |
| EINECS: | 219-739-7 |
| Molecular Formula: | C7H4ClNO4 |
| Molecular Weight: | 201.57 |
| InChI: | InChI=1/C7H4ClNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 50kgs |
| Density: | 1.6 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.627? |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | Yellow to brownish crystalline powder |
| HS Code: | 29163900 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
