| Identification | |
| Name: | Butanamide,N-(3-nitrophenyl)-3-oxo- |
| Synonyms: | Acetoacetanilide,3'-nitro- (6CI,7CI,8CI);3'-Nitroacetoacetanilide;N-(3-Nitrophenyl)acetoacetamide;NSC 165878; |
| CAS: | 25233-49-2 |
| Molecular Formula: | C10H10N2O4 |
| Molecular Weight: | 222.2 |
| InChI: | InChI=1/C10H10N2O4/c1-7(13)5-10(14)11-8-3-2-4-9(6-8)12(15)16/h2-4,6H,5H2,1H3,(H,11,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.35 g/cm3 |
| Refractive index: | 1.601 |
| Specification: |
The N-(3-Nitrophenyl)-3-oxobutanamide with the cas number 25233-49-2 is also called Butanamide,N-(3-nitrophenyl)-3-oxo-. Its molecular formula is C10H10N2O4. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.24; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.24; (4)ACD/LogD (pH 7.4): 1.23; (5)ACD/BCF (pH 5.5): 5.12; (6)ACD/BCF (pH 7.4): 5.04; (7)ACD/KOC (pH 5.5): 112; (8)ACD/KOC (pH 7.4): 110.18; (9)#H bond acceptors: 6; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 83.2 Å2; (13)Index of Refraction: 1.601; (14)Molar Refractivity: 56.36 cm3; (15)Molar Volume: 164.4 cm3; (16)Polarizability: 22.34×10-24cm3; (17)Surface Tension: 56.5 dyne/cm; (18)Enthalpy of Vaporization: 69.68 kJ/mol; (19)Vapour Pressure: 6.23×10-8 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
