| Identification | |
| Name: | Butanamide,N-(4-nitrophenyl)-3-oxo- |
| Synonyms: | Acetoacetanilide,4'-nitro- (6CI,7CI,8CI);4'-Nitroacetoacetanilide;N-(4-Nitrophenyl)-3-oxobutanamide;N-(4-Nitrophenyl)acetoacetamide;NSC 25193;p-Nitroacetoacetanilide; |
| CAS: | 4835-39-6 |
| EINECS: | 225-418-2 |
| Molecular Formula: | C10H10N2O4 |
| Molecular Weight: | 222.2 |
| InChI: | InChI=1/C10H10N2O4/c1-7(13)6-10(14)11-8-2-4-9(5-3-8)12(15)16/h2-5H,6H2,1H3,(H,11,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.331 g/cm3 |
| Refractive index: | 1.601 |
| Specification: |
The CAS register number of N-(4-Nitrophenyl)-3-oxobutyramide is 4835-39-6. It also can be called as 4'-Nitroacetoacetanilide and the IUPAC name about this chemical is N-(4-nitrophenyl)-3-oxobutanamide. The molecular formula about this chemical is C10H10N2O4 and molecular weight is 222.20. Physical properties about N-(4-Nitrophenyl)-3-oxobutyramide are: (1)ACD/LogP: 1.26; (2)ACD/LogD (pH 5.5): 0.64; (3)ACD/BCF (pH 5.5): 1.28; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 27.64; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 6; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 4; (10)Polar Surface Area: 91.99Å2; (11)Index of Refraction: 1.593; (12)Molar Refractivity: 56.57 cm3; (13)Molar Volume: 166.8 cm3; (14)Polarizability: 22.42x10-24cm3; (15)Surface Tension: 55.2 dyne/cm; (16)Enthalpy of Vaporization: 76.68 kJ/mol; (17)Boiling Point: 498.6 °C at 760 mmHg; (18)Vapour Pressure: 4.47E-10 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
