| Identification | |
| Name: | Acetic acid,2-(2,4,5-trichlorophenoxy)-, 2-butoxyethyl ester |
| Synonyms: | Aceticacid, (2,4,5-trichlorophenoxy)-, 2-butoxyethyl ester (6CI,7CI,8CI,9CI);Ethanol, 2-butoxy-, (2,4,5-trichlorophenoxy)acetate (8CI);(2,4,5-Trichlorophenoxy)acetic acid butoxyethanol ester; 2,4,5-T 2-butoxyethylester; 2,4,5-T Butoxyethanol ester; 2,4,5-T Butoxyethyl ester;2,4,5-Trichlorophenoxyacetic acid butoxyethyl ester; Bladex H; Butoxyethyl2,4,5-T; Butoxyethyl 2,4,5-trichlorophenoxyacetate; Hormoslyr 500T; Trinoxol;Weedone 2,4,5-T |
| CAS: | 2545-59-7 |
| EINECS: | 219-828-0 |
| Molecular Formula: | C14H17 Cl3 O4 |
| Molecular Weight: | 355.66 |
| InChI: | InChI=1/C14H17Cl3O4/c1-2-3-4-19-5-6-20-14(18)9-21-13-8-11(16)10(15)7-12(13)17/h7-8H,2-6,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 161°C |
| Boiling Point: | 434.9°C at 760 mmHg |
| Density: | 1.294g/cm3 |
| Refractive index: | 1.52 |
| Solubility: | Insol in water, sol in oils |
| Specification: |
2,4,5-T Butoxyethanol ester ,its cas register number is 2545-59-7. It also can be called Acetic acid, (2,4,5-trichlorophenoxy)-, 2-butoxyethyl ester ;and 2,4,5-T-butotyl [ISO] . |
| Flash Point: | 161°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
