| Identification | |
| Name: | Acetic acid,2-(2,4,5-trichlorophenoxy)-, butyl ester |
| Synonyms: | Aceticacid, (2,4,5-trichlorophenoxy)-, butyl ester (6CI,7CI,8CI,9CI);(2,4,5-Trichlorophenoxy)acetic acid butyl ester; 2,4,5-T Butyl ester; 2,4,5-Tn-Butyl ester; Agent Green; Arboricid; Butyl (2,4,5-trichlorophenoxy)acetate;Butyl 2,4,5-T; Flomore; Hi-Ester 2,4,5-T; Krzewotoks; Krzewotox; NSC 190448;Tormona; Trioxone; U 46KW; n-Butyl (2,4,5-trichlorophenoxy)acetate |
| CAS: | 93-79-8 |
| EINECS: | 202-277-5 |
| Molecular Formula: | C12H13 Cl3 O3 |
| Molecular Weight: | 311.60 |
| InChI: | InChI=1/C12H13Cl3O3/c1-2-3-4-17-12(16)7-18-11-6-9(14)8(13)5-10(11)15/h5-6H,2-4,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 142.2°C |
| Boiling Point: | 371.9°C at 760 mmHg |
| Density: | 1.324g/cm3 |
| Refractive index: | 1.528 |
| Solubility: | Insol in water; sol in oils. |
| Specification: |
The extinguishing agent of Butyl-2,4,5-trichlorophenoxyacetate (CAS No.93-79-8) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 142.2°C |
| Safety Data | |
 |
|
