Identification |
Name: | (p-chlorophenoxy)acetic acid, compound with 1,1-dimethylbiguanide (1:1) |
Synonyms: | Metformin p-chlorophenoxyacetate;Glucinan;Metformin p-chlorophenoxyacetate (salt);(p-Chlorophenoxy)acetic acid, compound with 1,1-dimethylbiguanide (1:1);Acetic acid, (4-chlorophenoxy)-, compd. with N,N-dimethylimidodicarbonimidic diamide (1:1);3-(diaminomethylidene)-1,1-dimethylguanidine |
CAS: | 25672-33-7 |
EINECS: | 247-177-2 |
Molecular Formula: | C4H11N5 |
Molecular Weight: | 129.1636 |
InChI: | InChI=1/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8) |
Molecular Structure: |
|
Properties |
Flash Point: | 89.3°C |
Boiling Point: | 224.1°C at 760 mmHg |
Density: | 1.28g/cm3 |
Refractive index: | 1.576 |
Flash Point: | 89.3°C |
Safety Data |
|
|