| Identification | |
| Name: | (p-chlorophenoxy)acetic acid, compound with 2,2'-iminodiethanol (1:1) |
| Synonyms: | Acetic acid, (4-chlorophenoxy)-, compd. with 2,2'-iminobis(ethanol) (1:1);4-Chlorophenoxyacetic acid diethanolamine salt;Acetic acid, (p-chlorophenoxy)-, compd. with 2,2'-iminodiethanol;Ethanol, 2,2'-iminobis-, (4-chlorophenoxy)acetate (salt);(p-Chlorophenoxy)acetic acid, compound with 2,2'-iminodiethanol (1:1);Diethanolamine 4-chlorophenoxyacetate;(4-chlorophenoxy)acetic acid - 2,2'-iminodiethanol (1:1) |
| CAS: | 53404-23-2 |
| EINECS: | 258-526-3 |
| Molecular Formula: | C12H18ClNO5 |
| Molecular Weight: | 291.728 |
| InChI: | InChI=1/C8H7ClO3.C4H11NO2/c9-6-1-3-7(4-2-6)12-5-8(10)11;6-3-1-5-2-4-7/h1-4H,5H2,(H,10,11);5-7H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 144.4°C |
| Boiling Point: | 315.2°C at 760 mmHg |
| Flash Point: | 144.4°C |
| Safety Data | |
 |
|
