| Identification | |
| Name: | Acetic acid,triethylplumbyl ester |
| Synonyms: | Lead,acetoxytriethyl- (7CI); Plumbane, (acetyloxy)triethyl- (9CI); Plumbane,acetoxytriethyl- (8CI); Triethyllead acetate (6CI); Acetoxytriethyllead;Acetoxytriethylplumbane; NSC 102508 |
| CAS: | 2587-81-7 |
| Molecular Formula: | C8H18 O2 Pb |
| Molecular Weight: | 353.45 |
| InChI: | InChI=1/C2H4O2.3C2H5.Pb/c1-2(3)4;3*1-2;/h1H3,(H,3,4);3*1H2,2H3;/rC6H15Pb.C2H4O2/c1-4-7(5-2)6-3;1-2(3)4/h4-6H2,1-3H3;1H3,(H,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Report: |
Lead and its compounds are on the Community Right-To-Know List. |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
N: Dangerous for the environment
|
 |
|
