| Identification | |
| Name: | 2-Furancarboxylic acid,triethylplumbyl ester |
| Synonyms: | Plumbane,triethyl[(2-furanylcarbonyl)oxy]- (9CI) |
| CAS: | 73928-18-4 |
| Molecular Formula: | C11H18 O3 Pb |
| Molecular Weight: | 439.55 |
| InChI: | InChI=1/C5H4O3.3C2H5.Pb/c6-5(7)4-2-1-3-8-4;3*1-2;/h1-3H,(H,6,7);3*1H2,2H3;/rC6H15Pb.C5H4O3/c1-4-7(5-2)6-3;6-5(7)4-2-1-3-8-4/h4-6H2,1-3H3;1-3H,(H,6,7) |
| Molecular Structure: | ![(C11H18O3Pb) Plumbane,triethyl[(2-furanylcarbonyl)oxy]- (9CI)](https://img1.guidechem.com/chem/e/dict/39/73928-18-4.jpg) |
| Properties | |
| Flash Point: | 94.2°C |
| Boiling Point: | 232.1°C at 760 mmHg |
| Specification: |
Triethyl lead furoate , its cas register number is 73928-18-4. It also can be called (Furoyloxy)triethyl plumbane ; and Plumbane, (furoyloxy)triethyl- . |
| Report: |
Lead and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 94.2°C |
| Safety Data | |
 |
|
