Identification |
Name: | butyl prop-2-enoate; 1,1-dichloroethene; 2-methylprop-2-enoate |
Synonyms: | 2-Propenoic acid, butyl ester, polymer with 1,1-dichloroethene and methyl 2-propenoate;Vinylidene chloride, butyl acrylate, methyl acrylate polymer |
CAS: | 25988-90-3 |
Molecular Formula: | C13H19Cl2O4- |
Molecular Weight: | 0 |
InChI: | InChI=1/C7H12O2.C4H6O2.C2H2Cl2/c1-3-5-6-9-7(8)4-2;1-3(2)4(5)6;1-2(3)4/h4H,2-3,5-6H2,1H3;1H2,2H3,(H,5,6);1H2/p-1 |
Molecular Structure: |
![(C13H19Cl2O4-) 2-Propenoic acid, butyl ester, polymer with 1,1-dichloroethene and methyl 2-propenoate;Vinylidene ch...](https://img1.guidechem.com/chem/e/dict/53/168455.png) |
Properties |
Flash Point: | 39.4°C |
Boiling Point: | 145.9°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 39.4°C |
Safety Data |
|
![](/images/detail_15.png) |