Identification |
Name: | butyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate; prop-2-enoic acid |
Synonyms: | acrylic acid; butyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate;26898-31-7;AC1Q66TA;AC1L528C;Methyl methacrylate, butyl methacrylate, acrylic acid resin;AR-1H6541;Acrylic acid, methyl methacrylate, butyl methacrylate polymer;butyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate; prop-2-enoic acid;2-Propenoic acid, 2-methyl-, butyl ester, polymer with methyl 2-methyl-2-propenoate and 2-propenoic acid |
CAS: | 438552-03-5 |
Molecular Formula: | C16H26O6 |
Molecular Weight: | 314.37404 |
InChI: | InChI=1S/C8H14O2.C5H8O2.C3H4O2/c1-4-5-6-10-8(9)7(2)3;1-4(2)5(6)7-3;1-2-3(4)5/h2,4-6H2,1,3H3;1H2,2-3H3;2H,1H2,(H,4,5) |
Molecular Structure: |
|
Properties |
Flash Point: | 50.6°C |
Boiling Point: | 160°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 50.6°C |
Safety Data |
|
|