| Identification |
| Name: | methyl 2-methylprop-2-enoate; methyl prop-2-enoate; 2-methylprop-2-enoic acid |
| Synonyms: | MPM 06;AK-624;Methacrylic acid, polymer with methyl acrylate and methyl methacrylate;Methyl acrylate, methyl methacrylate, methacrylic acid polymer;2-Methyl-2-propenoic acid polymer with methyl 2-methyl-2-propenoate and methyl 2-propenoate;methyl 2-methylprop-2-enoate; methyl prop-2-enoate; 2-methylprop-2-enoic acid;2-Propenoic acid, 2-methyl-, polymer with methyl 2-methyl-2-propenoate and methyl 2-propenoate;AC1L4PMQ;AC1Q5YJG;AR-1J4846;AR-1J4847;LS-123711;123478-82-0;26936-24-3;328569-85-3;335427-13-9 |
| CAS: | 123478-82-0;26936-24-3;61419-44-1 |
| Molecular Formula: | C13H20O6 |
| Molecular Weight: | 272.2943 |
| InChI: | InChI=1/C5H8O2.2C4H6O2/c1-4(2)5(6)7-3;1-3-4(5)6-2;1-3(2)4(5)6/h1H2,2-3H3;3H,1H2,2H3;1H2,2H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 10°C |
| Boiling Point: | 100.3°C at 760 mmHg |
| Flash Point: | 10°C |
| Safety Data |
| |
 |
