| Identification | |
| Name: | Benzeneacetic acid,4-propyl- |
| Synonyms: | Aceticacid, (p-propylphenyl)- (8CI);4-Propylbenzeneacetic acid;4-Propylphenylaceticacid; |
| CAS: | 26114-12-5 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C11H14O2/c1-2-3-9-4-6-10(7-5-9)8-11(12)13/h4-7H,2-3,8H2,1H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.072 g/cm3 |
| Refractive index: | 1.532 |
| Specification: |
The CAS register number of 4-Propylphenylacetic acid is 26114-12-5. It also can be called as Benzeneacetic acid,4-propyl- and the systematic name about this chemical is (4-propylphenyl)acetic acid. The molecular formula about this chemical is C11H14O2 and the molecular weight is 178.23. Physical properties about 4-Propylphenylacetic acid are: (1)ACD/LogP: 3.03; (2)ACD/LogD (pH 5.5): 1.89; (3)ACD/LogD (pH 7.4): 0.09; (4)ACD/BCF (pH 5.5): 8.52; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 76.5; (7)ACD/KOC (pH 7.4): 1.22; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 4; (11)Polar Surface Area: 26.3Å2; (12)Index of Refraction: 1.532; (13)Molar Refractivity: 51.54 cm3; (14)Molar Volume: 166.2 cm3; (15)Polarizability: 20.43x10-24cm3; (16)Surface Tension: 41.5 dyne/cm; (17)Enthalpy of Vaporization: 57.47 kJ/mol; (18)Boiling Point: 304 °C at 760 mmHg; (19)Vapour Pressure: 0.000396 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
