| Identification |
| Name: | Benzeneacetic acid, a-methyl-4-propyl- |
| Synonyms: | Hydratropicacid, p-propyl- (8CI); 2-(4-n-Propylphenyl)propionic acid;2-(p-Propylphenyl)propionic acid; p-Propylhydratropic acid |
| CAS: | 3585-47-5 |
| Molecular Formula: | C12H16 O2 |
| Molecular Weight: | 192.25 |
| InChI: | InChI=1/C12H16O2/c1-3-4-10-5-7-11(8-6-10)9(2)12(13)14/h5-9H,3-4H2,1-2H3,(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 207.5°C |
| Boiling Point: | 310.5°C at 760 mmHg |
| Density: | 1.047g/cm3 |
| Refractive index: | 1.524 |
| Flash Point: | 207.5°C |
| Usage: | Analogue of Ibuprofen and Flurbiprofen |
| Safety Data |
| |
 |
