| Identification |
| Name: | Benzeneacetic acid,4-methyl- |
| Synonyms: | Aceticacid, p-tolyl- (6CI,7CI,8CI);(4-Methylphenyl)acetic acid;2-(4-Methylphenyl)acetic acid;2-p-Tolylacetic acid;4-Methylbenzeneaceticacid;4-Tolylacetic acid;NSC 65595;p-Methylphenylacetic acid;p-Tolylaceticacid;4-Methylphenylacetic acid; |
| CAS: | 622-47-9 |
| EINECS: | 210-738-7 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.1745 |
| InChI: | InChI=1S/C9H10O2/c1-7-3-5-9(6-4-7)11-8(2)10/h3-6H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.127 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | 4850 mg/l in water |
| Solubility: | 4850 mg/l in water |
| Appearance: | white to off-white crystals |
| HS Code: | 29163900 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
