| Identification |
| Name: | 2,4-dichlorophenyl isocyanate |
| Synonyms: | 2,4-Dichloro-1-phenyl isocyanate; ISOCYANIC ACID 2,4-DICHLOROPHENYL ESTER; 2,4-DICHLOROISOCYANATOBENZENE; 1,3-dichloro-4-isocyanatobenzene; 1,3-dichloro-4-phenylisocyanate; 2,4-dichloro-1-phenylisocyanate; TIMTEC-BB SBB006720; 2,4-Dichlorophenylisocyantae; 2-Dichlorophenyl isocyanate |
| CAS: | 2612-57-9 |
| EINECS: | 220-040-4 |
| Molecular Formula: | C7H3Cl2NO |
| Molecular Weight: | 188.01 |
| InChI: | InChI=1/C7H3Cl2NO/c8-5-1-2-7(10-4-11)6(9)3-5/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2250 |
| Density: | 1.37 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.575 |
| Water Solubility: | decomposes |
| Solubility: | Decomposes in water |
| Appearance: | white to beige crystalline solid |
| Packinggroup: | II |
| HS Code: | 29291090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Usage: | Monoisocyanates are used as chemical intermediates in the production of drugs, pesticides, amines, ureas and other carbamoyl compounds. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
