| Identification |
| Name: | 2-Propenoic acid, 2-ethylhexyl ester, 2-methyl-2-propenoic acid, styrene polymer |
| Synonyms: | 2-Propenoic acid, 2-methyl-, polymer with ethenylbenzene and 2-ethylhexyl 2-propenoate;2-Propenoic acid, 2-ethylhexyl ester, 2-methyl-2-propenoic acid, styrene polymer |
| CAS: | 26636-08-8 |
| Molecular Formula: | C23H34O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C11H20O2.C8H8.C4H6O2/c1-4-6-7-10(5-2)8-9(3)11(12)13;1-2-8-6-4-3-5-7-8;1-3(2)4(5)6/h10H,3-8H2,1-2H3,(H,12,13);2-7H,1H2;1H2,2H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 192°C |
| Boiling Point: | 285.9°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 192°C |
| Safety Data |
| |
 |
