| Identification | |
| Name: | Cyclohexanecarboxylicacid, tributylstannyl ester |
| Synonyms: | Stannane,tributyl[(cyclohexylcarbonyl)oxy]- (8CI,9CI); Tin,tributyl[(cyclohexylcarbonyl)oxy]- (7CI) |
| CAS: | 2669-35-4 |
| Molecular Formula: | C19H38 O2 Sn |
| Molecular Weight: | 417.26 |
| InChI: | InChI=1/C7H12O2.3C4H9.Sn/c8-7(9)6-4-2-1-3-5-6;3*1-3-4-2;/h6H,1-5H2,(H,8,9);3*1,3-4H2,2H3;/rC12H27Sn.C7H12O2/c1-4-7-10-13(11-8-5-2)12-9-6-3;8-7(9)6-4-2-1-3-5-6/h4-12H2,1-3H3;6H,1-5H2,(H,8,9) |
| Molecular Structure: | ![(C19H38O2Sn) Stannane,tributyl[(cyclohexylcarbonyl)oxy]- (8CI,9CI); Tin,tributyl[(cyclohexylcarbonyl)oxy]- (7CI)](https://img1.guidechem.com/chem/e/dict/85/2669-35-4.jpg) |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Tributyltin cyclohexanecarboxylate , its cas register number is 2669-35-4. It also can be called Cyclohexanecarboxylic acid, tributylstannyl ester ; Stannane, ((cyclohexylcarbonyl)oxy)tributyl- ; and ((Cyclohexylcarbonyl)oxy)tributylstannane . |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
