| Identification | |
| Name: | Benzene, nitro- |
| Synonyms: | Benzene,nitro-, polymers (8CI); Nitrobenzene homopolymer; Poly(nitrobenzene) |
| CAS: | 26969-40-4 |
| Molecular Formula: | C6H5NO2 |
| Molecular Weight: | 123.1094 |
| InChI: | InChI=1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 5.7 deg C |
| Flash Point: | 81.4°C |
| Boiling Point: | 210.8°Cat760mmHg |
| Density: | 1.215g/cm3 |
| Solubility: | Slightly soluble in carbon tetrachloride; very soluble in ethanol, diethyl ether, acetone, benzene Soluble in ~500 parts water; freely soluble in alcohol, benzene, ether, oils Readily soluble in most organic solvents and is completely miscible with diethyl ether, benzene, and alcohol. Slightly soluble in water with a solublity of 0.19% at 20 deg C and 0.8% at 80 deg C In water, 2.09X10+3 mg/L at 25 deg C |
| Flash Point: | 81.4°C |
| Color: | Greenish-yellow crystals or yellow, oily liquid Colorless to yellow, oily liquid (Note: A solid below 42 degrees F). Bright-yellow crystals or pale-yellow to colorless, oily liquid |
| Safety Data | |
 |
|
