| Identification | |
| Name: | Benzenamine, chloro- |
| Synonyms: | Aniline,chloro- (8CI); Chloroaniline |
| CAS: | 27134-26-5 |
| Molecular Formula: | C6H6 Cl N |
| Molecular Weight: | 127.57154 |
| InChI: | InChI=1S/C6H6ClN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -14 deg C |
| Boiling Point: | 208.8 deg C |
| Solubility: | Soluble in acid and in most organic solvents. Miscible in alcohol and ether Soluble in alcohol, ether, benzene, and acetone. In water, 8165 mg/L at 25 deg C |
| Color: | Amber liquid Water-white to tan liquid Colorless liquid |
| Safety Data | |
 |
|
