Identification |
Name: | Pentanone |
Synonyms: | Pentanone |
CAS: | 27154-67-2 |
Molecular Formula: | C5H10 O |
Molecular Weight: | 0 |
InChI: | InChI=1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | -76.8 deg C |
Flash Point: | 12.2°C |
Boiling Point: | 103.7°Cat760mmHg |
Density: | 0.794g/cm3 |
Solubility: | Slightly soluble in carbon tetrachloride Miscible with alcohol and ether In water, 4.3X10+4 mg/L at 25 deg C |
Flash Point: | 12.2°C |
Color: | Colorless liquid Colorless to water-white liquid |
Safety Data |
|
 |