| Identification | |
| Name: | Pentanone |
| Synonyms: | Pentanone |
| CAS: | 27154-67-2 |
| Molecular Formula: | C5H10 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -76.8 deg C |
| Flash Point: | 12.2°C |
| Boiling Point: | 103.7°Cat760mmHg |
| Density: | 0.794g/cm3 |
| Solubility: | Slightly soluble in carbon tetrachloride Miscible with alcohol and ether In water, 4.3X10+4 mg/L at 25 deg C |
| Flash Point: | 12.2°C |
| Color: | Colorless liquid Colorless to water-white liquid |
| Safety Data | |
 |
|
