| Identification |
| Name: | 2-Thiophenecarboxylicacid, ethyl ester |
| Synonyms: | 2-(Ethoxycarbonyl)thiophene;2-Thienylcarboxylic acid ethyl ester;Ethyl 2-thenoate;Ethyl thiophen-2-carboxylate;NSC 39455; |
| CAS: | 2810-04-0 |
| EINECS: | 220-554-9 |
| Molecular Formula: | C7H8O2S |
| Molecular Weight: | 156.2 |
| InChI: | InChI=1/C7H8O2S/c1-2-9-7(8)6-4-3-5-10-6/h3-5H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.162 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.525-1.527 |
| Solubility: | Insoluble |
| Appearance: | clear light yellow liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
