| Identification | |
| Name: | 2-Propenoic acid, ethyl ester, polymer with N-(hydroxymethyl)-2-propenamide and 2-propenamide |
| Synonyms: | 2-Propenoic acid, ethyl ester, polymer with N-(hydroxymethyl)-2-propenamide and 2-propenamide Acrylamide, ethyl acrylate, methylolacrylamide polymer;2-Propenoic acid, ethyl ester, polymer with N-(hydroxymethyl)-2-propenamide and 2-propenamide |
| CAS: | 28433-25-2 |
| Molecular Formula: | C12H20N2O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C5H8O2.C4H7NO2.C3H5NO/c1-3-5(6)7-4-2;1-2-4(7)5-3-6;1-2-3(4)5/h3H,1,4H2,2H3;2,6H,1,3H2,(H,5,7);2H,1H2,(H2,4,5) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 15.6°C |
| Boiling Point: | 99.5°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 15.6°C |
| Safety Data | |
 |
|
