Identification |
Name: | Benzene,1-chloro-3-methoxy- |
Synonyms: | Anisole,m-chloro- (6CI,7CI,8CI);1-Chloro-3-methoxybenzene;3-Chloroanisol;3-Chloromethoxybenzene;3-Methoxychlorobenzene;3-Methoxyphenyl chloride;m-Chloroanisole;m-Chloromethoxybenzene;m-Chlorophenyl methyl ether; |
CAS: | 2845-89-8 |
EINECS: | 220-642-7 |
Molecular Formula: | C7H7ClO |
Molecular Weight: | 142.58 |
InChI: | InChI=1/C7H7ClO/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.164 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
Refractive index: | 1.5345-1.5365 |
Solubility: | insoluble |
Appearance: | Clear light yellow liquid. |
HS Code: | 29093090 |
Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |