| Identification |
| Name: | Benzene,1-chloro-2-methoxy- |
| Synonyms: | Anisole,o-chloro- (6CI,7CI,8CI);1-Chloro-2-methoxybenzene;2-Chloromethoxybenzene;2-Chlorophenol methyl ether;2-Methoxy-1-chlorobenzene;2-Methoxyphenyl chloride;NSC 155175;o-Chloroanisole;o-Chloromethoxybenzene;o-Chlorophenyl methyl ether;o-Methoxychlorobenzene; |
| CAS: | 766-51-8 |
| EINECS: | 212-167-9 |
| Molecular Formula: | C7H7ClO |
| Molecular Weight: | 142.58 |
| InChI: | InChI=1/C7H7ClO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -27 |
| Density: | 1.123 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5435-1.5455 |
| Appearance: | clear slightly yellow liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
