| Identification | |
| Name: | Pyrazine,2-methoxy-3-methyl- |
| Synonyms: | 2-Methyl-3-methoxypyrazine;3-Methoxy-2-methylpyrazine;UNII-04O7CN9Q85;AC1L2AWW;ZINC00405269; |
| CAS: | 2847-30-5 |
| EINECS: | 220-651-6 |
| Molecular Formula: | C6H8N2O |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C6H8N2O/c1-5-6(9-2)8-4-3-7-5/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 3 |
| Boiling Point: | 48-52°C 10mm |
| Density: | 1.072 |
| Refractive index: | 1.5055-1.5075 |
| Appearance: | Clear colourless liquid |
| Specification: | clear colourless liquid Safety Statements:26-39-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
