| Identification | |
| Name: | 3-Furanthiol, 2-methyl- |
| Synonyms: | 2-Methyl-3-furylthiol;2-Methyl-3-mercaptofuran;Oxycyclothione 030;2-Methyl-3-mercapofuran; |
| CAS: | 28588-74-1 |
| EINECS: | 249-094-7 |
| Molecular Formula: | C5H6OS |
| Molecular Weight: | 114.16 |
| InChI: | InChI=1/C5H6OS/c1-4-5(7)2-3-6-4/h2-3,7H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1228 3/PG 3 |
| Density: | 1.145 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.51-1.55 |
| Solubility: | Slightly soluble |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
?3-Furanthiol, 2-methyl- (CAS NO.28588-74-1), its Synonyms are 2-Methyl-3-furanthiol ; 2-Methyl-3-furylmercaptan ; 2-Methyl-3-furylthiol ; 2-Methyl-3-mercaptofuran . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
