| Identification |
| Name: | 3-Fluorophenylhydrazine hydrochloride |
| Synonyms: | - |
| CAS: | 2924-16-5 |
| EINECS: | 220-886-4 |
| Molecular Formula: | C6H7FN2?HCl |
| Molecular Weight: | 162.59 |
| InChI: | InChI=1/C6H7FN2.ClH/c7-5-2-1-3-6(4-5)9-8;/h1-4,9H,8H2;1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | white to light yellow crystal powde |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
