| Identification | |
| Name: | 1H-Indene-1-carboxylicacid, 2,3-dihydro-3-oxo- |
| CAS: | 29427-69-8 |
| Molecular Formula: | C10H8 O3 |
| Molecular Weight: | 176.17 |
| InChI: | InChI=1/C10H8O3/c11-9-5-8(10(12)13)6-3-1-2-4-7(6)9/h1-4,8H,5H2,(H,12,13)/p-1/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 111-113 ºC |
| Flash Point: | 188.7°C |
| Boiling Point: | 365°Cat760mmHg |
| Density: | 1.384g/cm3 |
| Specification: |
1H-Indene-1-carboxylicacid, 2,3-dihydro-3-oxo- , its cas register number is 29427-69-8. It also can be called 2,3-Dihydro-3-oxo-1H-indene-1-carboxylic acid ; and 3-Oxo-2,3-dihydro-1H-indene-1-carboxylic acid . Its classification code is Drug / Therapeutic Agent. |
| Flash Point: | 188.7°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
