| Identification | |
| Name: | 1H-Indene-5-carboxylicacid, 2,3-dihydro-3-oxo- |
| Synonyms: | 5-Indancarboxylicacid, 3-oxo- (6CI); 3-Oxoindane-5-carboxylic acid; Indan-1-one-6-carboxylicacid |
| CAS: | 60031-08-5 |
| Molecular Formula: | C10H8 O3 |
| Molecular Weight: | 176.17 |
| InChI: | InChI=1/C10H8O3/c11-9-4-3-6-1-2-7(10(12)13)5-8(6)9/h1-2,5H,3-4H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 256-260 °C |
| Flash Point: | 194.9°C |
| Boiling Point: | 375.2°C at 760 mmHg |
| Density: | 1.381g/cm3 |
| Refractive index: | 1.631 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 194.9°C |
| Safety Data | |
 |
|
