| Identification | |
| Name: | N,N-Dimethylformamide sulfur trioxide complex |
| Synonyms: | SULFUR TRIOXIDE DIMETHYLFORMAMIDE COMPLEX;SULFUR TRIOXIDE N,N-DIMETHYLFORMAMIDE COMPLEX;N,N-DIMETHYLFORMAMIDE SULFUR TRIOXIDE COMPLEX;n,n-dimethyl-formamidcompd.withsulfurtrioxide(1:1);N,N-dimethylformamide, compound with sulphur trioxide;Sulphur trioxide N,N-dimethylformamide complex;Sulfur trioxide N,N-dimethylformamide complex,47+% active SO3 |
| CAS: | 29584-42-7 |
| EINECS: | 249-701-5 |
| Molecular Formula: | C3H7NO4S |
| Molecular Weight: | 153.16 |
| InChI: | InChI=1/C3H7NO.O3S/c1-4(2)3-5;1-4(2)3/h3H,1-2H3; |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Melting Point: | 155-158 °C(lit.) |
| Flash Point: | 57.8°C |
| Boiling Point: | 153°C at 760 mmHg |
| Stability: | Stable. Incompatible with strong oxidizing agents. Sensitive to moisture. |
| Packinggroup: | III |
| Flash Point: | 57.8°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
