| Identification | |
| Name: | N,N-Dimethylformamide |
| Synonyms: | DMF;DMF(amide);DMFA;Dimethylformamide;N,N-Dimethylformaldehyde;Formamide,N,N-dimethyl-;N,N-Dimethylmethanamide;N-Formyldimethylamine;NSC5356;Virodene-P 058; |
| CAS: | 68-12-2 |
| EINECS: | 200-679-5 |
| Molecular Formula: | C3H7NO |
| Molecular Weight: | 73.0938 |
| InChI: | InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2265 |
| Density: | 0.945 |
| Refractive index: | 1.429-1.432 |
| Alpha: | 0.94 o |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Clear colorless liquid |
| Packinggroup: | III |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Color: | Colorless to very slightly yellow liquid Water-white liquid |
| Usage: | An antihistamine with anticholinergic properties. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
