Identification |
Name: | formic acid, compound with N,N-dimethylformamide (1:1) |
Synonyms: | Formic acid, compd. with N,N-dimethylformamide (1:1);Formic acid, N,N-dimethylformamide salt;Formic acid, compound with N,N-dimethylformamide (1:1);formic acid - N,N-dimethylformamide (1:1) |
CAS: | 68258-70-8 |
EINECS: | 269-492-4 |
Molecular Formula: | C4H9NO3 |
Molecular Weight: | 119.1192 |
InChI: | InChI=1/C3H7NO.CH2O2/c1-4(2)3-5;2-1-3/h3H,1-2H3;1H,(H,2,3) |
Molecular Structure: |
|
Properties |
Flash Point: | 57.8°C |
Boiling Point: | 153°C at 760 mmHg |
Flash Point: | 57.8°C |
Safety Data |
|
|