| Identification |
| Name: | formic acid, compound with N,N-dimethylcyclohexylamine (1:1) |
| Synonyms: | Formic acid, compd. with N,N-dimethylcyclohexanamine (1:1);N,N-Dimethylcyclohexanamine, formate salt;Formic acid, compound with N,N-dimethylcyclohexylamine (1:1);formic acid - N,N-dimethylcyclohexanamine (1:1) |
| CAS: | 68459-80-3 |
| EINECS: | 270-618-5 |
| Molecular Formula: | C9H19NO2 |
| Molecular Weight: | 173.2527 |
| InChI: | InChI=1/C8H17N.CH2O2/c1-9(2)8-6-4-3-5-7-8;2-1-3/h8H,3-7H2,1-2H3;1H,(H,2,3) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 42.2°C |
| Boiling Point: | 162°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 42.2°C |
| Safety Data |
| |
 |
