| Identification |
| Name: | dodecenylsuccinic acid, compound with N,N-dimethylcyclohexylamine (1:2) |
| Synonyms: | Butanedioic acid, 2-dodecenyl-, compd. with N,N-dimethylcyclohexanamine (1:2);Succinic acid, dodecenyl-, compd. with N,N-dimethylcyclohexylamine (1:2);Butanedioic acid, dodecenyl-, compd. with N,N-dimethylcyclohexanamine (1:2);Dodecenylsuccinic acid, compound with N,N-dimethylcyclohexylamine (1:2);2-[(1E)-dodec-1-en-1-yl]butanedioic acid - N,N-dimethylcyclohexanamine (1:2) |
| CAS: | 65166-20-3 |
| EINECS: | 265-581-7 |
| Molecular Formula: | C32H62N2O4 |
| Molecular Weight: | 538.8457 |
| InChI: | InChI=1/C16H28O4.2C8H17N/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;2*1-9(2)8-6-4-3-5-7-8/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20);2*8H,3-7H2,1-2H3/b12-11+;; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 214.2°C |
| Boiling Point: | 407.2°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 214.2°C |
| Safety Data |
| |
 |
